CAS 79349-23-8
:2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol
Description:
2-(3-Methyl-1,2,4-oxadiazol-5-yl)phenol, with the CAS number 79349-23-8, is an organic compound characterized by the presence of a phenolic group and a 1,2,4-oxadiazole ring. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The oxadiazole moiety contributes to its potential biological activity, as compounds containing oxadiazole rings are often investigated for their antimicrobial, antifungal, and anticancer properties. The presence of the methyl group on the oxadiazole enhances its lipophilicity, which may influence its interaction with biological systems. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, affecting the compound's reactivity and solubility. Overall, 2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-6-10-9(13-11-6)7-4-2-3-5-8(7)12/h2-5,12H,1H3
SMILES:Cc1nc(c2ccccc2O)on1
Synonyms:- Phenol, 2-(3-methyl-1,2,4-oxadiazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
