CAS 79349-24-9

2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol

Description:

2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol, with the CAS number 79349-24-9, is an organic compound characterized by its unique structure that includes both a phenolic group and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential fluorescence, making it of interest in various applications, including materials science and organic electronics. The presence of the oxadiazole ring contributes to its stability and may impart specific electronic properties, which can be advantageous in photonic applications. Additionally, the phenolic group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The compound may also exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, its distinctive structural features and properties make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₄H₁₀N₂O₂

InChI: InChI=1S/C14H10N2O2/c17-12-9-5-4-8-11(12)14-15-13(16-18-14)10-6-2-1-3-7-10/h1-9,17H

InChI key: InChIKey=VNCIJMRFIRKERM-UHFFFAOYSA-N

SMILES: OC1=C(C=CC=C1)C2=NC(=NO2)C3=CC=CC=C3

Synonyms:

• 2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol
• Phenol, 2-(3-phenyl-1,2,4-oxadiazol-5-yl)-

2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol

CAS: 79349-24-9

2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol is a bifunctional antibiotic that inhibits bacterial growth by binding to DNA gyrase and topoisomerase IV. It has been used in research for its potential to treat immunodeficiency, mycoses, and fungal infections. 2-(3-Phenyl-1,2,4-oxadiazol-5-yl)phenol has shown the ability to inhibit the growth of a number of fungi including Candida albicans and Cryptococcus neoformans. This drug also exhibits fluorescence under UV light.

Formula: C₁₄H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-EDA34924