CymitQuimica logo

CAS 79350-14-4

:

5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2-amino-4-thiazolyl)oxoacetyl]amino]-3-ethenyl-8-oxo-, (6R-trans)-

Description:
5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2-amino-4-thiazolyl)oxoacetyl]amino]-3-ethenyl-8-oxo-, (6R-trans)-, with CAS number 79350-14-4, is a complex organic compound characterized by its bicyclic structure that incorporates both sulfur and nitrogen atoms. This compound features a thiazole moiety, which contributes to its biological activity, and is known for its potential pharmacological properties. The presence of the carboxylic acid functional group indicates acidic characteristics, while the ethenyl and oxo groups suggest reactivity and potential for further chemical modifications. Its stereochemistry, particularly the (6R-trans) configuration, is crucial for its biological interactions and efficacy. This compound is often studied in the context of medicinal chemistry, particularly for its role in antibiotic development or as a potential therapeutic agent. Its unique structural features and functional groups make it a subject of interest in drug design and development, particularly in targeting specific biological pathways.
Formula:C14H12N4O5S2
InChI:InChI=1S/C14H12N4O5S2/c1-2-5-3-24-12-7(11(21)18(12)8(5)13(22)23)17-10(20)9(19)6-4-25-14(15)16-6/h2,4,7,12H,1,3H2,(H2,15,16)(H,17,20)(H,22,23)/t7-,12-/m1/s1
InChI key:InChIKey=USEZCSSBFVPIRD-JMCQJSRRSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](NC(C(=O)C=3N=C(N)SC3)=O)C2=O)(SCC1C=C)[H]
Synonyms:
  • 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2-amino-4-thiazolyl)oxoacetyl]amino]-3-ethenyl-8-oxo-, (6R-trans)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.