CymitQuimica logo

CAS 79352-72-0

:

2-Aminomethyl-4-aminophenol

Description:
2-Aminomethyl-4-aminophenol, with the CAS number 79352-72-0, is an organic compound characterized by the presence of both amino and hydroxyl functional groups. It features a phenolic structure, which contributes to its potential reactivity and solubility in polar solvents. This compound typically appears as a solid and is known for its role in various chemical applications, including as an intermediate in the synthesis of dyes and pharmaceuticals. The presence of multiple amino groups suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, its structure may confer biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as compounds with amino groups can sometimes be associated with toxicity or environmental concerns. Overall, 2-Aminomethyl-4-aminophenol is a versatile compound with significant implications in both industrial and research settings.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c8-4-5-3-6(9)1-2-7(5)10/h1-3,10H,4,8-9H2
InChI key:InChIKey=PZKNKZNLQYKXFV-UHFFFAOYSA-N
SMILES:C(N)C1=C(O)C=CC(N)=C1
Synonyms:
  • 2-Aminomethyl-4-aminophenol
  • 4-Amino-2-(aminomethyl)phenol
  • Phenol, 4-amino-2-(aminomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.