CAS 79362-44-0
:(3-bromophenyl)(pyridin-3-yl)methanone
Description:
(3-bromophenyl)(pyridin-3-yl)methanone, with the CAS number 79362-44-0, is an organic compound characterized by its structure, which includes a brominated phenyl group and a pyridine moiety attached to a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of the carbonyl functional group. The bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, potentially enhancing its ability to participate in electrophilic substitution reactions. The pyridine ring contributes to the compound's basicity and can engage in coordination with metal ions, making it of interest in coordination chemistry. Additionally, the presence of both aromatic and heteroaromatic systems may impart unique electronic properties, which can be exploited in various applications, including pharmaceuticals and agrochemicals. Overall, (3-bromophenyl)(pyridin-3-yl)methanone is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C12H8BrNO
InChI:InChI=1/C12H8BrNO/c13-11-5-1-3-9(7-11)12(15)10-4-2-6-14-8-10/h1-8H
SMILES:c1cc(cc(c1)Br)C(=O)c1cccnc1
Synonyms:- Methanone, (3-Bromophenyl)-3-Pyridinyl-
- (3-Bromophenyl)(pyridin-3-yl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
