CymitQuimica logo

CAS 793658-98-7

:

methyl 4-(aminomethyl)tetrahydropyran-4-carboxylate

Description:
Methyl 4-(aminomethyl)tetrahydropyran-4-carboxylate is a chemical compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether containing one oxygen atom. This compound features an amino group (-NH2) attached to the carbon chain, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The presence of a carboxylate group (-COO-) indicates that it can participate in various chemical reactions, such as esterification and amidation. The methyl ester functionality enhances its solubility in organic solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. Its molecular structure suggests that it may exhibit biological activity, potentially serving as a precursor for drug development. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the tetrahydropyran ring. Overall, methyl 4-(aminomethyl)tetrahydropyran-4-carboxylate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C8H15NO3
InChI:InChI=1/C8H15NO3/c1-11-7(10)8(6-9)2-4-12-5-3-8/h2-6,9H2,1H3
SMILES:COC(=O)C1(CCOCC1)CN
Synonyms:
  • Methyl 4-(aminomethyl)tetrahydro-2H-pyran-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.