CAS 793675-05-5

(5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride

Description:

(5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. The presence of the methyl group on the pyridine ring contributes to its unique chemical properties, influencing its reactivity and interaction with biological systems. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with various biological targets, which could be explored in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of organic molecules that may have significant implications in research and development within the fields of chemistry and pharmacology.

Formula: C₁₁H₁₉Cl₂N₃

InChI: InChI=1/C11H17N3.2ClH/c1-9-2-3-11(13-8-9)14-10-4-6-12-7-5-10;;/h2-3,8,10,12H,4-7H2,1H3,(H,13,14);2*1H

SMILES: Cc1ccc(nc1)NC1CCNCC1.Cl.Cl