CymitQuimica logo

CAS 793678-97-4

:

4-Ethoxy-3-(1-pyrrolidinylsulfonyl)benzenamine

Description:
4-Ethoxy-3-(1-pyrrolidinylsulfonyl)benzenamine is a chemical compound characterized by its unique structure, which includes an ethoxy group and a pyrrolidinylsulfonyl moiety attached to a benzene ring. This compound typically exhibits properties associated with both aromatic amines and sulfonamides, which may influence its solubility, reactivity, and biological activity. The presence of the ethoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. The pyrrolidinylsulfonyl group may contribute to its interaction with biological targets, making it of interest in medicinal chemistry. Such compounds are often investigated for their potential therapeutic applications, including roles in drug development for various diseases. Additionally, the compound's stability, melting point, and solubility in different solvents can vary based on its molecular structure and functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with amines and sulfonamides.
Formula:C12H18N2O3S
InChI:InChI=1S/C12H18N2O3S/c1-2-17-11-6-5-10(13)9-12(11)18(15,16)14-7-3-4-8-14/h5-6,9H,2-4,7-8,13H2,1H3
InChI key:InChIKey=XYFUPSOGWOVIPI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(OCC)C=CC(N)=C1)N2CCCC2
Synonyms:
  • 4-Ethoxy-3-(1-pyrrolidinylsulfonyl)benzenamine
  • Pyrrolidine, 1-[(5-amino-2-ethoxyphenyl)sulfonyl]-
  • Benzenamine, 4-ethoxy-3-(1-pyrrolidinylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.