CymitQuimica logo

CAS 793679-01-3

:

2-Chloro-N-ethyl-N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]acetamide

Description:
2-Chloro-N-ethyl-N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]acetamide, with the CAS number 793679-01-3, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an ethyl amine moiety, and a fluorophenyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its amine and carbonyl functionalities. The presence of the chloro and fluorine substituents may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in drug development, particularly in the context of targeting specific receptors or enzymes. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 2-Chloro-N-ethyl-N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]acetamide represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C13H16ClFN2O2
InChI:InChI=1S/C13H16ClFN2O2/c1-2-17(13(19)7-14)9-12(18)16-8-10-3-5-11(15)6-4-10/h3-6H,2,7-9H2,1H3,(H,16,18)
InChI key:InChIKey=CMJSSXKGIYWLIU-UHFFFAOYSA-N
SMILES:C(NC(CN(C(CCl)=O)CC)=O)C1=CC=C(F)C=C1
Synonyms:
  • Acetamide, 2-chloro-N-ethyl-N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]-
  • 2-Chloro-N-ethyl-N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.