CAS 793681-94-4
:4-(Dimethoxymethylsilyl)-2-methylbutanenitrile
Description:
4-(Dimethoxymethylsilyl)-2-methylbutanenitrile is an organosilicon compound characterized by the presence of a silyl group, which enhances its reactivity and solubility in organic solvents. This compound features a nitrile functional group, which is known for its ability to participate in various chemical reactions, including nucleophilic additions and polymerization processes. The dimethoxymethylsilyl group contributes to its stability and may influence its physical properties, such as boiling point and solubility. Typically, compounds like this are utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to their ability to act as intermediates or building blocks. The presence of the methyl group in the structure can also affect steric hindrance and reactivity. Overall, 4-(Dimethoxymethylsilyl)-2-methylbutanenitrile is a versatile compound with potential applications in various fields of chemistry, particularly in synthetic organic chemistry.
Formula:C8H17NO2Si
InChI:InChI=1S/C8H17NO2Si/c1-8(7-9)5-6-12(4,10-2)11-3/h8H,5-6H2,1-4H3
InChI key:InChIKey=XYVLBSAFHCWHDF-UHFFFAOYSA-N
SMILES:[Si](CCC(C#N)C)(OC)(OC)C
Synonyms:- 3-Cyanobutylmethyldimethoxysilane
- 4-(Dimethoxymethylsilyl)-2-methylbutanenitrile
- Butanenitrile, 4-(dimethoxymethylsilyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.