CAS 793690-07-0

5-[[(2-Furanylmethyl)amino]sulfonyl]-2-methylbenzoic acid

Description:

5-[[(2-Furanylmethyl)amino]sulfonyl]-2-methylbenzoic acid, with the CAS number 793690-07-0, is a chemical compound characterized by its unique structure that includes a benzoic acid moiety substituted with a sulfonamide group and a furanylmethyl amino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the sulfonyl and carboxylic acid functional groups. The furanylmethyl group may contribute to its reactivity and biological activity, potentially allowing for interactions with various biological targets. The presence of the sulfonamide group suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's molecular structure may impart specific characteristics such as stability under certain conditions, while its functional groups may influence its acidity, polarity, and overall reactivity. As with many organic compounds, its behavior in chemical reactions and interactions with other substances would depend on the specific conditions and environments in which it is used.

Formula: C₁₃H₁₃NO₅S

InChI: InChI=1S/C13H13NO5S/c1-9-4-5-11(7-12(9)13(15)16)20(17,18)14-8-10-3-2-6-19-10/h2-7,14H,8H2,1H3,(H,15,16)

InChI key: InChIKey=KFEKRAITVQJBTK-UHFFFAOYSA-N

SMILES: S(NCC1=CC=CO1)(=O)(=O)C2=CC(C(O)=O)=C(C)C=C2

Synonyms:

• 5-[[(2-Furanylmethyl)amino]sulfonyl]-2-methylbenzoic acid
• Benzoic acid, 5-[[(2-furanylmethyl)amino]sulfonyl]-2-methyl-