CAS 793695-17-7

(αS)-3,5-Dichloro-α-methyl-2-pyridinemethanamine

Description:

(αS)-3,5-Dichloro-α-methyl-2-pyridinemethanamine, with the CAS number 793695-17-7, is a chemical compound characterized by its pyridine ring structure, which is substituted with two chlorine atoms and an amino group. This compound features a chiral center, indicated by the (αS) designation, which implies that it exists in a specific stereoisomeric form. The presence of the dichloro substituents contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and pharmacology. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the compound's structural features suggest potential applications in the development of pharmaceuticals, particularly in areas targeting specific receptors or enzymes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties, such as melting point, solubility, and spectral data, would be essential for further studies and applications.

Formula: C₇H₈Cl₂N₂

InChI: InChI=1S/C7H8Cl2N2/c1-4(10)7-6(9)2-5(8)3-11-7/h2-4H,10H2,1H3/t4-/m0/s1

InChI key: InChIKey=IEIMANXIFJWWFP-BYPYZUCNSA-N

SMILES: [C@@H](C)(N)C1=C(Cl)C=C(Cl)C=N1

Synonyms:

• 2-Pyridinemethanamine, 3,5-dichloro-α-methyl-, (αS)-
• (S)-1-(3,5-Dichloropyridin-2-yl)ethanamine
• (αS)-3,5-Dichloro-α-methyl-2-pyridinemethanamine
• (1S)-1-(3,5-Dichloropyridin-2-yl)ethan-1-amine