
CAS 793695-89-3
:5-Iodo-2-methoxybenzenemethanamine
Description:
5-Iodo-2-methoxybenzenemethanamine, with the CAS number 793695-89-3, is an organic compound characterized by its aromatic structure, which includes a methoxy group and an amino group attached to a benzene ring. The presence of the iodine atom at the 5-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, making it a candidate for use in medicinal chemistry and material science. The amino group provides basicity and can participate in hydrogen bonding, which may affect the compound's interactions with biological targets. Overall, this compound's unique functional groups and structural features make it of interest for further research in synthetic organic chemistry and potential pharmaceutical applications.
Formula:C8H10INO
InChI:InChI=1S/C8H10INO/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4H,5,10H2,1H3
InChI key:InChIKey=WOVHZZTWPMSZNC-UHFFFAOYSA-N
SMILES:O(C)C1=C(CN)C=C(I)C=C1
Synonyms:- (5-Iodo-2-methoxyphenyl)methanamine
- 2-Methoxy-5-iodobenzylamine
- 5-Iodo-2-methoxybenzenemethanamine
- Benzenemethanamine, 5-iodo-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
