CAS 793695-91-7

3-[3-(Aminomethyl)phenyl]-2-propyn-1-ol

Description:

3-[3-(Aminomethyl)phenyl]-2-propyn-1-ol, with the CAS number 793695-91-7, is an organic compound characterized by its unique structure that includes a propynol group and an aminomethyl-substituted phenyl ring. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds due to the hydroxyl (-OH) and amine (-NH2) functional groups. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as an intermediate in organic synthesis. The presence of the propynyl group may impart unique reactivity, making it suitable for further chemical modifications. Additionally, the compound's solubility in polar solvents is expected due to the hydroxyl group, while its aromatic structure may contribute to its stability and interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₀H₁₁NO

InChI: InChI=1S/C10H11NO/c11-8-10-4-1-3-9(7-10)5-2-6-12/h1,3-4,7,12H,6,8,11H2

InChI key: InChIKey=JZQFSQRVZXRYAR-UHFFFAOYSA-N

SMILES: C(#CCO)C1=CC(CN)=CC=C1

Synonyms:

• 2-Propyn-1-ol, 3-[3-(aminomethyl)phenyl]-
• 3-[3-(Aminomethyl)phenyl]-2-propyn-1-ol