CymitQuimica logo

CAS 79371-66-7

:

4-[1-(4-Hydroxyphenyl)-1-methylethyl]-1,2-benzenediol

Description:
4-[1-(4-Hydroxyphenyl)-1-methylethyl]-1,2-benzenediol, also known as a derivative of bisphenol, is a chemical compound characterized by its complex structure featuring multiple hydroxyl groups and aromatic rings. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure suggests it may possess antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms to neutralize free radicals. Additionally, the compound's hydrophobic and hydrophilic characteristics may influence its solubility in different solvents, affecting its reactivity and interaction with biological systems. The presence of the hydroxyphenyl and methylethyl groups may also contribute to its biological activity, making it a subject of interest in medicinal chemistry. Overall, this compound's unique structural features and potential functionalities make it a valuable candidate for further research and application in various chemical and biological contexts.
Formula:C15H16O3
InChI:InChI=1S/C15H16O3/c1-15(2,10-3-6-12(16)7-4-10)11-5-8-13(17)14(18)9-11/h3-9,16-18H,1-2H3
InChI key:InChIKey=YGFAMQHMUSBLBC-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC(O)=C(O)C=C1)C2=CC=C(O)C=C2
Synonyms:
  • 1,2-Benzenediol, 4-[1-(4-hydroxyphenyl)-1-methylethyl]-
  • 2-(4-Hydroxyphenyl)-2-(3,4-dihydroxyphenyl)propane
  • 4-[1-(4-Hydroxyphenyl)-1-methylethyl]-1,2-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.