CAS 793716-00-4

Pyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylic acid, 3,4-dihydro-, 2,2-dioxide

Description:

Pyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylic acid, 3,4-dihydro-, 2,2-dioxide, identified by CAS number 793716-00-4, is a heterocyclic compound featuring a thiadiazine ring structure. This compound is characterized by its unique bicyclic framework, which includes a pyrazine moiety fused to a thiadiazine ring. The presence of a carboxylic acid functional group contributes to its acidic properties, while the 2,2-dioxide indicates the presence of two oxo groups, enhancing its reactivity and potential for forming hydrogen bonds. The dihydro configuration suggests that the compound may exist in a reduced form, which can influence its stability and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound represents a class of heterocycles that can be explored for various applications in pharmaceuticals and agrochemicals.

Formula: C₇H₇N₃O₄S

InChI: InChI=1S/C7H7N3O4S/c11-7(12)5-6-9-15(13,14)4-3-10(6)2-1-8-5/h1-2H,3-4H2,(H,11,12)

InChI key: InChIKey=VQJCHIMWYDPSIB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2N(CCS(=O)(=O)N2)C=CN1

Synonyms:

• 2,2-Dioxo-3H,4H-2λ6-pyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylic acid
• Pyrazino[2,1-c][1,2,4]thiadiazine-9-carboxylic acid, 3,4-dihydro-, 2,2-dioxide