CymitQuimica logo

CAS 793716-10-6

:

2,3-Dihydro-3-(6-methyl-2-pyridinyl)-2-thioxo-4(1H)-quinazolinone

Description:
2,3-Dihydro-3-(6-methyl-2-pyridinyl)-2-thioxo-4(1H)-quinazolinone is a chemical compound characterized by its unique structure, which includes a quinazolinone core fused with a thioxo group and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the thioxo group may contribute to its reactivity and interaction with biological targets. Additionally, the methyl group on the pyridine ring can influence its lipophilicity and solubility, affecting its pharmacokinetic properties. The compound may also display various functional properties, including potential antioxidant or antimicrobial activities, depending on its specific interactions within biological systems. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,3-Dihydro-3-(6-methyl-2-pyridinyl)-2-thioxo-4(1H)-quinazolinone represents a class of compounds that may hold promise for further research in drug development and therapeutic applications.
Formula:C14H11N3OS
InChI:InChI=1S/C14H11N3OS/c1-9-5-4-8-12(15-9)17-13(18)10-6-2-3-7-11(10)16-14(17)19/h2-8H,1H3,(H,16,19)
InChI key:InChIKey=JQARLDIXYFSBSO-UHFFFAOYSA-N
SMILES:O=C1N(C(=S)NC=2C1=CC=CC2)C=3N=C(C)C=CC3
Synonyms:
  • 2,3-Dihydro-3-(6-methyl-2-pyridinyl)-2-thioxo-4(1H)-quinazolinone
  • 4(1H)-Quinazolinone, 2,3-dihydro-3-(6-methyl-2-pyridinyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.