CAS 793716-21-9

5-[[(Diphenylmethyl)amino]sulfonyl]-2-methylbenzoic acid

Description:

5-[[(Diphenylmethyl)amino]sulfonyl]-2-methylbenzoic acid, identified by its CAS number 793716-21-9, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a sulfonamide group. This compound features a diphenylmethyl group attached to the nitrogen of the sulfonamide, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both acidic (carboxylic acid) and basic (amino) functional groups suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its sulfonamide group may also impart specific pharmacological activities, such as antibacterial or anti-inflammatory effects. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of sulfonamide derivatives that may have applications in drug development and other chemical research fields.

Formula: C₂₁H₁₉NO₄S

InChI: InChI=1S/C21H19NO4S/c1-15-12-13-18(14-19(15)21(23)24)27(25,26)22-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,20,22H,1H3,(H,23,24)

InChI key: InChIKey=ZBYCTOQAJCFYKH-UHFFFAOYSA-N

SMILES: C(NS(=O)(=O)C1=CC(C(O)=O)=C(C)C=C1)(C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• Benzoic acid, 5-[[(diphenylmethyl)amino]sulfonyl]-2-methyl-
• 5-[[(Diphenylmethyl)amino]sulfonyl]-2-methylbenzoic acid

5-[(Diphenylmethyl)sulfamoyl]-2-methylbenzoic acid

CAS: 793716-21-9

Versatile small molecule scaffold

Formula: C₂₁H₁₉NO₄S

Purity: Min. 95%

Molecular weight: 381.4 g/mol

Ref: 3D-TGB71621