CAS 793727-56-7

N-[2-(4-Bromophenoxy)-5-(trifluoromethyl)phenyl]-2-chloroacetamide

Description:

N-[2-(4-Bromophenoxy)-5-(trifluoromethyl)phenyl]-2-chloroacetamide is a synthetic organic compound characterized by its complex structure, which includes a chloroacetamide functional group and a phenyl ring substituted with both bromine and trifluoromethyl groups. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased lipophilicity and potential biological activity. The presence of the bromine and trifluoromethyl groups can enhance its reactivity and influence its interactions with biological targets, making it of interest in medicinal chemistry and agrochemical applications. The chloroacetamide moiety may contribute to its potential as a pharmacophore, affecting its solubility and stability. Additionally, the compound's molecular structure suggests it may exhibit specific electronic and steric properties, which can be crucial for its function in biological systems. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and pharmaceutical fields.

Formula: C₁₅H₁₀BrClF₃NO₂

InChI: InChI=1S/C15H10BrClF3NO2/c16-10-2-4-11(5-3-10)23-13-6-1-9(15(18,19)20)7-12(13)21-14(22)8-17/h1-7H,8H2,(H,21,22)

InChI key: InChIKey=GKRUPPNCKGJTEE-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=C(OC2=CC=C(Br)C=C2)C=CC(C(F)(F)F)=C1

Synonyms:

• N-[2-(4-Bromophenoxy)-5-(trifluoromethyl)phenyl]-2-chloroacetamide
• Acetamide, N-[2-(4-bromophenoxy)-5-(trifluoromethyl)phenyl]-2-chloro-