CymitQuimica logo

CAS 793727-85-2

:

3,5-Dimethyl-4-(2-methyl-1-oxopropyl)-1H-pyrrole-2-carboxylic acid

Description:
3,5-Dimethyl-4-(2-methyl-1-oxopropyl)-1H-pyrrole-2-carboxylic acid is a pyrrole derivative characterized by its unique structure, which includes a pyrrole ring substituted with two methyl groups and a carboxylic acid functional group. The presence of the 2-methyl-1-oxopropyl side chain contributes to its complexity and potential biological activity. This compound may exhibit properties typical of pyrrole derivatives, such as potential antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its molecular structure suggests it could participate in various chemical reactions, including esterification and amidation, due to the carboxylic acid group. The compound's solubility, stability, and reactivity would be influenced by the functional groups present, making it of interest in synthetic organic chemistry and medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further research would be necessary to fully elucidate its properties and applications.
Formula:C11H15NO3
InChI:InChI=1S/C11H15NO3/c1-5(2)10(13)8-6(3)9(11(14)15)12-7(8)4/h5,12H,1-4H3,(H,14,15)
InChI key:InChIKey=IRXBKLCZUFUTBK-UHFFFAOYSA-N
SMILES:C(C(C)C)(=O)C=1C(C)=C(C(O)=O)NC1C
Synonyms:
  • 1H-Pyrrole-2-carboxylic acid, 3,5-dimethyl-4-(2-methyl-1-oxopropyl)-
  • 3,5-Dimethyl-4-(2-methyl-1-oxopropyl)-1H-pyrrole-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.