CAS 793727-87-4

4-Chloro-2-(4-morpholinylmethyl)-5-(2-thienyl)thieno[2,3-d]pyrimidine

Description:

4-Chloro-2-(4-morpholinylmethyl)-5-(2-thienyl)thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core fused with a thienyl group and a morpholinylmethyl substituent. This compound features a chlorine atom at the 4-position, contributing to its reactivity and potential biological activity. The presence of the morpholine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its thienyl substituent may enhance lipophilicity, influencing its pharmacokinetic properties. The compound is typically synthesized through multi-step organic reactions, and its properties can include moderate solubility in organic solvents and stability under standard laboratory conditions. As a member of the thieno-pyrimidine class, it may exhibit various biological activities, including potential anti-cancer or anti-inflammatory effects, although specific biological data would depend on empirical studies. Overall, this compound represents a significant interest in drug discovery and development due to its unique structural features and potential therapeutic applications.

Formula: C₁₅H₁₄ClN₃OS₂

InChI: InChI=1S/C15H14ClN3OS2/c16-14-13-10(11-2-1-7-21-11)9-22-15(13)18-12(17-14)8-19-3-5-20-6-4-19/h1-2,7,9H,3-6,8H2

InChI key: InChIKey=UXFJFUKIWFLMNH-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CSC2=NC(CN3CCOCC3)=N1)C4=CC=CS4

Synonyms:

• 4-Chloro-2-(4-morpholinylmethyl)-5-(2-thienyl)thieno[2,3-d]pyrimidine
• Thieno[2,3-d]pyrimidine, 4-chloro-2-(4-morpholinylmethyl)-5-(2-thienyl)-

4-{[4-Chloro-5-(thiophen-2-yl)thieno[2,3-d]pyrimidin-2-yl]methyl}morpholine

CAS: 793727-87-4

Versatile small molecule scaffold

Formula: C₁₅H₁₄ClN₃OS₂

Purity: Min. 95%

Molecular weight: 351.9 g/mol

Ref: 3D-TGB72787