CAS 79373-03-8

2-(biphenyl-4-yl)indolizine

Description:

2-(Biphenyl-4-yl)indolizine is an organic compound characterized by its unique structure, which combines an indolizine core with a biphenyl substituent. This compound typically exhibits a planar configuration, contributing to its potential for strong π-π stacking interactions, which can influence its electronic properties. It is generally soluble in organic solvents, making it suitable for various applications in organic electronics, such as in the development of organic light-emitting diodes (OLEDs) and organic photovoltaics. The presence of both the indolizine and biphenyl moieties can impart interesting photophysical properties, including fluorescence and absorption characteristics, which are valuable for optoelectronic applications. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, 2-(biphenyl-4-yl)indolizine represents a versatile building block in the field of organic chemistry, particularly in materials science and medicinal chemistry.

Formula: C₂₀H₁₅N

InChI: InChI=1/C20H15N/c1-2-6-16(7-3-1)17-9-11-18(12-10-17)19-14-20-8-4-5-13-21(20)15-19/h1-15H

Synonyms:

• Indolizine, 2-[1,1'-biphenyl]-4-yl-
• 2-(4-Biphenylyl)indolizine
• 2-(4-Biphenylyl)indolizin
• 2-(Biphenyl-4-yl)indolizine