CAS 79379-02-5
:3,5-Dimethyl-4-(2-chloroethyl)-isoxazole
Description:
3,5-Dimethyl-4-(2-chloroethyl)-isoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features two methyl groups at the 3 and 5 positions of the isoxazole ring, contributing to its hydrophobic character and potentially influencing its biological activity. The presence of a 2-chloroethyl substituent at the 4-position introduces a reactive site, which may enhance its reactivity and potential applications in medicinal chemistry. The compound is typically synthesized through specific organic reactions that involve the formation of the isoxazole ring and subsequent substitution reactions. Its properties, such as solubility, stability, and reactivity, can vary based on the functional groups present and the overall molecular structure. While specific data on its biological activity may not be widely available, compounds with similar structures often exhibit interesting pharmacological properties, making them subjects of research in drug development and other chemical applications.
Formula:C7H10ClNO
InChI:InChI=1/C7H10ClNO/c1-5-7(3-4-8)6(2)10-9-5/h3-4H2,1-2H3
SMILES:Cc1c(CCCl)c(C)on1
Synonyms:- 4-(2-Chloroethyl)-3,5-Dimethyl-1,2-Oxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
