CAS 79383-00-9

2-(4-Chloromethylphenyl)-5-methyl-1,3,4-oxadiazole

Description:

2-(4-Chloromethylphenyl)-5-methyl-1,3,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a chloromethyl group attached to a phenyl ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the methyl group on the oxadiazole ring enhances its lipophilicity, which can influence its biological activity and solubility. Typically, compounds like this exhibit interesting properties such as fluorescence, which can be utilized in imaging or sensing applications. Additionally, the structural features may impart antimicrobial or anti-inflammatory properties, making it a candidate for drug development. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 2-(4-Chloromethylphenyl)-5-methyl-1,3,4-oxadiazole represents a versatile structure in organic chemistry with potential utility in various scientific and industrial applications.

Formula: C₁₀H₉ClN₂O

InChI: InChI=1/C10H9ClN2O/c1-7-12-13-10(14-7)9-4-2-8(6-11)3-5-9/h2-5H,6H2,1H3

SMILES: Cc1nnc(c2ccc(cc2)CCl)o1