CymitQuimica logo

CAS 79383-45-2

:

2-Methoxy-α,α,6-trimethylbenzenemethanol

Description:
2-Methoxy-α,α,6-trimethylbenzenemethanol, also known by its CAS number 79383-45-2, is an organic compound characterized by its complex structure, which includes a methoxy group and a benzenemethanol framework. This compound features a benzene ring substituted with three methyl groups at the 2, 4, and 6 positions, contributing to its hydrophobic nature and potential for various interactions in chemical reactions. The presence of the methoxy group enhances its solubility in organic solvents while also influencing its reactivity and polarity. Typically, compounds of this nature may exhibit properties such as moderate volatility and potential applications in fragrance or flavor industries due to their aromatic characteristics. Additionally, the presence of hydroxyl (-OH) functional groups can impart hydrogen bonding capabilities, affecting the compound's physical properties, such as boiling point and solubility in water. Overall, 2-Methoxy-α,α,6-trimethylbenzenemethanol is a versatile compound with potential applications in various fields, including organic synthesis and materials science.
Formula:C11H16O2
InChI:InChI=1S/C11H16O2/c1-8-6-5-7-9(13-4)10(8)11(2,3)12/h5-7,12H,1-4H3
InChI key:InChIKey=GNRHHKWDAXVRSU-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=C(OC)C=CC=C1C
Synonyms:
  • 2-(2-Methoxy-6-methylphenyl)-2-propanol
  • 2-Methoxy-α,α,6-trimethylbenzenemethanol
  • Benzenemethanol, 2-methoxy-α,α,6-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.