CymitQuimica logo

CAS 79386-05-3

:

1-(2-{4-[(3R,4R)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy}ethyl)pyrrolidine hydrochloride

Description:
1-(2-{4-[(3R,4R)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy}ethyl)pyrrolidine hydrochloride is a synthetic compound characterized by its complex structure, which includes a pyrrolidine ring and a chromene moiety. This substance is typically classified as a pharmaceutical compound, potentially exhibiting biological activity due to its structural features. The presence of the methoxy group and the phenyl ring suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or other cellular pathways. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability for therapeutic applications. The compound's stereochemistry, indicated by the (3R,4R) configuration, may play a crucial role in its pharmacological properties, affecting how it interacts with biological receptors. Overall, this compound represents a class of molecules that may have potential uses in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C30H36ClNO3
InChI:InChI=1/C30H35NO3.ClH/c1-30(2)29(23-9-5-4-6-10-23)28(26-16-15-25(32-3)21-27(26)34-30)22-11-13-24(14-12-22)33-20-19-31-17-7-8-18-31;/h4-6,9-16,21,28-29H,7-8,17-20H2,1-3H3;1H/t28-,29+;/m1./s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.