CymitQuimica logo

CAS 79386-91-7

:

4-(3-Chloropropyl)-2-thiazolamine

Description:
4-(3-Chloropropyl)-2-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a chloropropyl group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the amine functional group indicates that it can participate in hydrogen bonding and may exhibit basic properties. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The chlorine atom in the chloropropyl side chain can enhance the compound's reactivity, making it useful in nucleophilic substitution reactions. Additionally, the thiazole moiety is often associated with biological activity, which may suggest potential therapeutic applications. However, specific safety and handling guidelines should be followed due to the presence of chlorine and the potential for toxicity. As with any chemical substance, understanding its properties, reactivity, and safety profile is crucial for its effective use in research and industry.
Formula:C6H9ClN2S
InChI:InChI=1S/C6H9ClN2S/c7-3-1-2-5-4-10-6(8)9-5/h4H,1-3H2,(H2,8,9)
InChI key:InChIKey=OQMGWRRBJOZEBU-UHFFFAOYSA-N
SMILES:C(CCCl)C=1N=C(N)SC1
Synonyms:
  • 2-Thiazolamine, 4-(3-chloropropyl)-
  • 4-(3-Chloropropyl)-2-thiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.