CAS 79398-27-9

Methyl 4,6-dihydroxynicotinate

Description:

Methyl 4,6-dihydroxynicotinate, with the CAS number 79398-27-9, is an organic compound derived from nicotinic acid, featuring hydroxyl groups at the 4 and 6 positions of the pyridine ring. This compound is characterized by its methyl ester functional group, which enhances its solubility in organic solvents. It typically appears as a crystalline solid and is known for its potential biological activities, including antioxidant properties. The presence of hydroxyl groups contributes to its reactivity, allowing for various chemical modifications. Methyl 4,6-dihydroxynicotinate may also exhibit interactions with biological systems, making it of interest in pharmaceutical research, particularly in the development of compounds targeting neurological conditions. Its synthesis often involves esterification reactions and can be achieved through various organic synthesis methods. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₇NO₄

InChI: InChI=1/C7H7NO4/c1-12-7(11)4-3-8-6(10)2-5(4)9/h2-3H,1H3,(H2,8,9,10)

SMILES: COC(=O)c1cnc(cc1O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 4,6-Dihydroxy-, Methyl Ester
• Methyl 6-Hydroxy-4-Oxo-1,4-Dihydropyridine-3-Carboxylate
• Methyl 4,6-dihydroxynicotinate

Methyl 4,6-dihydroxynicotinate

CAS: 79398-27-9

Formula: C₇H₇NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.1348

Ref: IN-DA005210

Methyl 4,6-dihydroxynicotinate

CAS: 79398-27-9

Methyl 4,6-dihydroxynicotinate

Purity: 98%

Molecular weight: 169.13g/mol

Ref: 54-OR46224