CymitQuimica logo

CAS 794-00-3

:

5-fluoro-7,12-dimethyltetraphene

Description:
5-Fluoro-7,12-dimethyltetraphene, identified by its CAS number 794-00-3, is a polycyclic aromatic hydrocarbon characterized by its complex structure, which includes multiple fused benzene rings. This compound features a fluorine atom and two methyl groups attached to specific positions on the tetraphene framework, influencing its chemical properties and reactivity. Generally, polycyclic aromatic hydrocarbons like this one exhibit hydrophobic characteristics, making them less soluble in water but more soluble in organic solvents. They often display interesting electronic properties, which can be leveraged in organic electronics and materials science. The presence of the fluorine atom can enhance the stability and alter the electronic distribution within the molecule, potentially affecting its photophysical properties. Additionally, compounds of this nature may have implications in environmental chemistry due to their persistence and potential toxicity. Overall, 5-fluoro-7,12-dimethyltetraphene serves as a notable example of the diverse chemistry associated with polycyclic aromatic compounds.
Formula:C20H15F
InChI:InChI=1/C20H15F/c1-12-14-7-3-4-8-15(14)13(2)20-17-10-6-5-9-16(17)19(21)11-18(12)20/h3-11H,1-2H3
SMILES:Cc1c2ccccc2c(C)c2c3ccccc3c(cc12)F
Synonyms:
  • 5-Fluoro-7,12-dimethylbenz[a]anthracene
  • Benz[A]Anthracene, 5-Fluoro-7,12-Dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.