CAS 79406-10-3
:(3α,4α)-3-[[(2E)-1-Oxo-3-phenyl-2-propen-1-yl]oxy]kaur-16-en-18-oic acid
Description:
The chemical substance known as "(3α,4α)-3-[[(2E)-1-Oxo-3-phenyl-2-propen-1-yl]oxy]kaur-16-en-18-oic acid," with the CAS number 79406-10-3, is a complex organic compound that belongs to the class of kaurenoic acids, which are derived from the kaurene skeleton. This compound features a unique structure characterized by a kaurene backbone, which includes multiple stereocenters, contributing to its potential biological activity. The presence of a phenyl group and an α,β-unsaturated carbonyl moiety indicates that it may exhibit reactivity typical of such functional groups, potentially allowing for interactions with biological macromolecules. Its specific stereochemistry may influence its pharmacological properties, making it of interest in medicinal chemistry. Additionally, compounds of this nature are often studied for their potential applications in agriculture, particularly as plant growth regulators or in the development of novel therapeutic agents. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C29H36O4
InChI:InChI=1S/C29H36O4/c1-19-17-29-16-13-22-27(2,23(29)11-10-21(19)18-29)15-14-24(28(22,3)26(31)32)33-25(30)12-9-20-7-5-4-6-8-20/h4-9,12,21-24H,1,10-11,13-18H2,2-3H3,(H,31,32)/b12-9+/t21-,22+,23+,24-,27-,28+,29-/m1/s1
InChI key:InChIKey=BJQOPHXIKHSJOP-OLJRGKMISA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@@](CC3)(C(=C)C4)[H])CC[C@@]1([C@@](C(O)=O)(C)[C@H](OC(/C=C/C5=CC=CC=C5)=O)CC2)[H])[H]
Synonyms:- Kaur-16-en-18-oic acid, 3-[(1-oxo-3-phenyl-2-propenyl)oxy]-, [3α(E),4α]-
- Kaur-16-en-18-oic acid, 3-[[(2E)-1-oxo-3-phenyl-2-propen-1-yl]oxy]-, (3α,4α)-
- (3α,4α)-3-[[(2E)-1-Oxo-3-phenyl-2-propen-1-yl]oxy]kaur-16-en-18-oic acid
- Kaur-16-en-18-oic acid, 3-[[(2E)-1-oxo-3-phenyl-2-propenyl]oxy]-, (3α,4α)-
- 3α-Cinnamoyloxy-ent-kaur-16-en-19-oic acid
- ent-3β-Cinnamoyloxykaur-16-en-19-oic acid
- ent-3β-CinnaMoyloxykaur-16-en-19-oicaci
- ent-3beta-Cinnamoyloxykaur-16-en-19-oic acid
- ENT-3Β-CINNAMOYLOXYKAUR-16-EN-19
- ent-3β-CinnaMoyloxykaur-16-en-19-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
ent-3β-Cinnamoyloxykaur-16-en-19-oic acid
CAS:ent-3beta-Cinnamoyloxykaur-16-en-19-oic acid is a natural product for research related to life sciences.Formula:C29H36O4Purity:98%Color and Shape:SolidMolecular weight:448.59ent-3β-Cinnamoyloxykaur-16-en-19-oic acid
CAS:Formula:C29H36O4Purity:95%~99%Color and Shape:PowderMolecular weight:448.603Ent-3beta-cinnamoyloxykaur-16-en-19-oic acid
CAS:Ent-3beta-cinnamoyloxykaur-16-en-19-oic acid is a diterpenoid compound, which is a type of naturally occurring chemical found in certain plant species. It is derived from kaurane, a diterpene skeleton, and is known for its complex structural features that include a cinnamoyloxy group. The source of this compound is typically plant species such as those from the Asteraceae or Lamiaceae families, where it can be isolated through advanced extraction and purification techniques.
Formula:C29H36O4Purity:Min. 95%Molecular weight:448.6 g/mol



