
CAS 79418-77-2
:2-Fluoro-4-hydroxy-5-methoxybenzaldehyde
Description:
2-Fluoro-4-hydroxy-5-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of a fluorine atom at the second position, a hydroxyl group at the fourth position, and a methoxy group at the fifth position on the benzene ring contributes to its unique chemical properties. This compound is typically a pale yellow to light brown solid and is soluble in organic solvents. Its molecular structure allows for potential hydrogen bonding due to the hydroxyl group, which can influence its reactivity and interactions with other molecules. The fluorine substituent can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the methoxy group can serve as an electron-donating group, further modifying the electronic properties of the compound. Overall, 2-Fluoro-4-hydroxy-5-methoxybenzaldehyde is a versatile compound with applications in various chemical syntheses and research areas.
Formula:C8H7FO3
InChI:InChI=1S/C8H7FO3/c1-12-8-2-5(4-10)6(9)3-7(8)11/h2-4,11H,1H3
InChI key:InChIKey=DDEFOLHFKVPOFE-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(OC)=C(O)C=C1F
Synonyms:- Benzaldehyde, 2-fluoro-4-hydroxy-5-methoxy-
- 2-Fluoro-4-hydroxy-5-methoxybenzaldehyde
- 6-Fluoro-4-hydroxy-3-methoxybenzaldehyde
- 6-Fluorovanillin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.