CAS 79419-54-8

(3R,6R)-6-[(2-cyclohexyl-4-methyl-6-oxo-1-pyridyl)oxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid

Description:

The chemical substance known as (3R,6R)-6-[(2-cyclohexyl-4-methyl-6-oxo-1-pyridyl)oxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid, with the CAS number 79419-54-8, is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and contains multiple hydroxyl (-OH) groups that contribute to its hydrophilicity and potential for hydrogen bonding. The presence of a carboxylic acid group (-COOH) indicates acidic properties, while the pyridine moiety introduces aromatic characteristics and potential for various interactions, such as coordination with metal ions. The cyclohexyl and methyl substituents enhance the compound's hydrophobic character, influencing its solubility and biological activity. This compound may exhibit significant pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stereochemistry, denoted by the (3R,6R) configuration, suggests specific spatial arrangements that can affect its reactivity and interactions with biological targets.

Formula: C₁₈H₂₅NO₈

InChI: InChI=1/C18H25NO8/c1-9-7-11(10-5-3-2-4-6-10)19(12(20)8-9)27-18-15(23)13(21)14(22)16(26-18)17(24)25/h7-8,10,13-16,18,21-23H,2-6H2,1H3,(H,24,25)/t13?,14-,15?,16?,18-/m1/s1

SMILES: Cc1cc(C2CCCCC2)n(c(=O)c1)O[C@@H]1C(C([C@H](C(C(=O)O)O1)O)O)O

Ciclopirox Glucuronide Lithium Salt

CAS: 79419-54-8

Formula: C₁₈H₂₄NO₈·Li

Color and Shape: White To Off-White Solid

Molecular weight: 382.39 6.94

Ref: 4Z-C-051

Ciclopirox D-glucuronide

CAS: 79419-54-8

Ref: 7W-GC7570

Ciclopirox β-D-Glucuronide

Controlled Product

CAS: 79419-54-8

Applications A metabolite of Ciclopirox.
References Kellner, H.M., et al.: Arzneim.-Forch., 31, 1337 (1981),

Formula: C₁₈H₂₅NO₈

Color and Shape: Neat

Molecular weight: 383.39

Ref: TR-C432810

Ciclopirox D-glucuronide sodium salt

CAS: 79419-54-8

Ciclopirox D-glucuronide sodium salt is a synthetic chemical that belongs to the group of glycosylated and fluorinated ciclopirox. It has been modified to improve its activity and stability. Ciclopirox D-glucuronide sodium salt is a high purity product with a custom synthesis and modification process. This chemical is useful for the synthesis of carbohydrate-based drugs, polysaccharides, saccharides, and complex carbohydrates.

Formula: C₁₈H₂₄NO₈·Na

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 405.37 g/mol

Ref: 3D-MC09480