CAS 79424-03-6
:ethyl 4,4,4-trifluoro-2-butynoate
Description:
Ethyl 4,4,4-trifluoro-2-butynoate is an organic compound characterized by its unique trifluoromethyl and alkyne functional groups. It features a butynoate structure, which includes a terminal alkyne and an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of three fluorine atoms on the carbon adjacent to the carbonyl enhances the compound's electrophilicity, making it a valuable intermediate in various chemical reactions, including nucleophilic additions and coupling reactions. This compound is typically a colorless liquid with a distinctive odor, and it is soluble in organic solvents. Its trifluoromethyl group imparts unique physical and chemical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Ethyl 4,4,4-trifluoro-2-butynoate is of interest in medicinal chemistry and materials science due to its potential as a building block for more complex fluorinated compounds. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C6H5F3O2
InChI:InChI=1/C6H5F3O2/c1-2-11-5(10)3-4-6(7,8)9/h2H2,1H3
SMILES:CCOC(=O)C#CC(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 4,4,4-trifluoro-2-butynoate, 97%
CAS:<p>Ethyl 4,4,4-trifluoro-2-butynoate is the suitable reagent used to investigate the regioselectivity of the insertion reaction with cyclometalated iridium and rhodium complexes. It may be used in the preparation of ethyl (Z)-3-iodo-4,4,4-trifluoro-2-butenoate. This Thermo Scientific Chemicals brand pr</p>Formula:C6H5F3O2Purity:97%Molecular weight:166.1Ethyl 4,4,4-trifluorobut-2-ynoate
CAS:Formula:C6H5F3O2Purity:98%Color and Shape:LiquidMolecular weight:166.0979Ref: IN-DA0034V2
1g43.00€5g90.00€10g120.00€25g161.00€50g269.00€100g582.00€250gTo inquire100mg25.00€250mg27.00€Ethyl 4,4,4-trifluorobut-2-ynoate
CAS:Ethyl 4,4,4-trifluorobut-2-ynoateFormula:C6H5F3O2Purity:96%Color and Shape: clear. yellow liquidMolecular weight:166.10g/molEthyl 4,4,4-Trifluorobut-2-ynoate
CAS:Formula:C6H5F3O2Purity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:166.10Ethyl 4,4,4-trifluorobutynoate
CAS:Formula:C6H5F3O2Purity:95%Color and Shape:LiquidMolecular weight:166.099




