CymitQuimica logo

CAS 79433-96-8

:

Methyl 5-hydroxy-3-cyclohexene-1-carboxylate

Description:
Methyl 5-hydroxy-3-cyclohexene-1-carboxylate, with the CAS number 79433-96-8, is an organic compound characterized by its cyclohexene structure, which features a hydroxyl group and a carboxylate ester functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the hydroxyl group contributes to its reactivity, allowing for hydrogen bonding and influencing its solubility in polar solvents. Additionally, the cyclohexene ring provides a degree of rigidity and can participate in various chemical reactions, such as electrophilic additions. The ester functionality suggests that it may undergo hydrolysis or transesterification under appropriate conditions. Overall, Methyl 5-hydroxy-3-cyclohexene-1-carboxylate is of interest in both academic research and industrial applications due to its unique structural features and reactivity.
Formula:C8H12O3
InChI:InChI=1S/C8H12O3/c1-11-8(10)6-3-2-4-7(9)5-6/h2,4,6-7,9H,3,5H2,1H3
InChI key:InChIKey=UQSMDPAVFOFIGB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(O)C=CC1
Synonyms:
  • 3-Cyclohexene-1-carboxylic acid, 5-hydroxy-, methyl ester
  • Methyl 5-hydroxy-3-cyclohexene-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.