CAS 79441-22-8

N5-Phenyl-2,5-pyridinediamine

Description:

N5-Phenyl-2,5-pyridinediamine, with the CAS number 79441-22-8, is an organic compound characterized by its pyridine ring structure substituted with two amino groups and a phenyl group. This compound typically exhibits properties associated with aromatic amines, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of amino groups can impart basicity and reactivity, allowing for participation in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the phenyl group contributes to the compound's hydrophobic characteristics and can influence its electronic properties. N5-Phenyl-2,5-pyridinediamine may also exhibit biological activity, making it of interest in medicinal chemistry and materials science. However, as with many aromatic amines, it is essential to consider safety and toxicity profiles, as some derivatives can be hazardous. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and application in various chemical fields.

Formula: C₁₁H₁₁N₃

InChI: InChI=1S/C11H11N3/c12-11-7-6-10(8-13-11)14-9-4-2-1-3-5-9/h1-8,14H,(H2,12,13)

InChI key: InChIKey=RZBFVVRYQHWXAU-UHFFFAOYSA-N

SMILES: N(C=1C=CC(N)=NC1)C2=CC=CC=C2

Synonyms:

• N5-Phenyl-2,5-pyridinediamine
• 2,5-Pyridinediamine, N5-phenyl-