
CAS 79442-37-8
:(2E)-3-(4-Chlorophenyl)-1-(2-thienyl)-2-propen-1-one
Description:
(2E)-3-(4-Chlorophenyl)-1-(2-thienyl)-2-propen-1-one, commonly referred to as a chalcone derivative, is an organic compound characterized by its conjugated double bond system, which contributes to its potential biological activity. This compound features a 4-chlorophenyl group and a 2-thienyl group attached to a propenone backbone, giving it unique electronic properties and reactivity. Chalcones are known for their role in various biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. The presence of the chlorophenyl group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the thienyl moiety may contribute to its stability and solubility in organic solvents. The compound's structure allows for potential applications in medicinal chemistry and materials science, particularly in the development of novel pharmaceuticals and agrochemicals. Its synthesis typically involves the Claisen-Schmidt condensation reaction, making it accessible for further functionalization and study.
Formula:C13H9ClOS
InChI:InChI=1S/C13H9ClOS/c14-11-6-3-10(4-7-11)5-8-12(15)13-2-1-9-16-13/h1-9H/b8-5+
InChI key:InChIKey=BNSHKSGHHCPPDV-VMPITWQZSA-N
SMILES:C(/C=C/C1=CC=C(Cl)C=C1)(=O)C2=CC=CS2
Synonyms:- 2-Propen-1-one, 3-(4-chlorophenyl)-1-(2-thienyl)-, (E)-
- 2-Propen-1-one, 3-(4-chlorophenyl)-1-(2-thienyl)-, (2E)-
- (2E)-3-(4-Chlorophenyl)-1-(2-thienyl)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.