CAS 794461-85-1

5,6,7,8-Tetrahydro-2-(trifluoromethyl)-1,7-naphthyridine

Description:

5,6,7,8-Tetrahydro-2-(trifluoromethyl)-1,7-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. The compound's molecular structure contributes to its potential as a building block in the synthesis of various biologically active molecules. Additionally, the presence of nitrogen atoms in the ring system can impart basicity and influence its interaction with biological targets. As with many heterocycles, it may exhibit unique properties such as fluorescence or specific reactivity patterns, which can be exploited in medicinal chemistry and material science. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.

Formula: C₉H₉F₃N₂

InChI: InChI=1S/C9H9F3N2/c10-9(11,12)8-2-1-6-3-4-13-5-7(6)14-8/h1-2,13H,3-5H2

InChI key: InChIKey=KXEOITUVISETBJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C2C(=CC1)CCNC2

Synonyms:

• 1,7-Naphthyridine, 5,6,7,8-tetrahydro-2-(trifluoromethyl)-
• 5,6,7,8-Tetrahydro-2-(trifluoromethyl)-1,7-naphthyridine
• 2-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine