CAS 794465-47-7

1-[6-(Aminomethyl)-2-methyl-3-pyridinyl]ethanone

Description:

1-[6-(Aminomethyl)-2-methyl-3-pyridinyl]ethanone, with the CAS number 794465-47-7, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aminomethyl group, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the ethanone functional group indicates that it has ketone characteristics, which can influence its reactivity and interactions with other molecules. The methyl group on the pyridine ring adds to its hydrophobic character, potentially affecting its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in drug development and research. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-[6-(Aminomethyl)-2-methyl-3-pyridinyl]ethanone represents a versatile structure in the realm of organic and medicinal chemistry.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c1-6-9(7(2)12)4-3-8(5-10)11-6/h3-4H,5,10H2,1-2H3

InChI key: InChIKey=XVWVEGDNEWNSCI-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C)N=C(CN)C=C1

Synonyms:

• Ethanone, 1-[6-(aminomethyl)-2-methyl-3-pyridinyl]-
• 1-[6-(Aminomethyl)-2-methyl-3-pyridinyl]ethanone