CAS 794469-79-7

1-Aminocyclopropaneethanamine

Description:

1-Aminocyclopropaneethanamine, also known as 1-aminocyclopropanecarboxylic acid, is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring. This compound features an amino group (-NH2) and an ethylamine side chain, contributing to its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the amino group allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound is of interest in the field of medicinal chemistry and plant biology, as it may play a role in the biosynthesis of plant hormones like ethylene. Its unique structure and functional groups make it a valuable compound for research in organic synthesis and pharmacology. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₅H₁₂N₂

InChI: InChI=1S/C5H12N2/c6-4-3-5(7)1-2-5/h1-4,6-7H2

InChI key: InChIKey=ASADPWMASHWPHP-UHFFFAOYSA-N

SMILES: C(CN)C1(N)CC1

Synonyms:

• 1-(2-Aminoethyl)cyclopropanamine
• 1-(2-Aminoethyl)cyclopropan-1-amine
• 1-Aminocyclopropaneethanamine
• Cyclopropaneethanamine, 1-amino-