CAS 794472-18-7

3-Bromo-β-fluorobenzeneethanamine

Description:

3-Bromo-β-fluorobenzeneethanamine, with the CAS number 794472-18-7, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with an ethylamine side chain. This compound features a bromine atom at the meta position relative to the amine group and a fluorine atom at the beta position of the ethylamine. The presence of these halogens can significantly influence the compound's reactivity, polarity, and potential biological activity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of both a bromine and a fluorine atom can enhance the compound's lipophilicity, potentially affecting its solubility and interaction with biological membranes. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental impact.

Formula: C₈H₉BrFN

InChI: InChI=1S/C8H9BrFN/c9-7-3-1-2-6(4-7)8(10)5-11/h1-4,8H,5,11H2

InChI key: InChIKey=CWAHHQSCBWJANH-UHFFFAOYSA-N

SMILES: C(CN)(F)C1=CC(Br)=CC=C1

Synonyms:

• 2-(3-Bromophenyl)-2-fluoroethan-1-amine
• 2-(3-Bromo-phenyl)-2-fluoro-ethylamine
• 2-(3-Bromophenyl)-2-fluoroethanamine
• 3-Bromo-β-fluorobenzeneethanamine
• Benzeneethanamine, 3-bromo-β-fluoro-