CAS 794495-34-4
:1H-Imidazole-5-carboxylic acid, 2-cyclopentyl-
Description:
1H-Imidazole-5-carboxylic acid, 2-cyclopentyl- is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the imidazole ring, contributing to its acidic properties. The presence of a cyclopentyl group at the 2-position adds to its structural complexity and may influence its solubility and reactivity. Generally, imidazole derivatives are known for their biological activity, including roles in pharmaceuticals and biochemistry, due to their ability to participate in hydrogen bonding and coordination with metal ions. The specific properties of this compound, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential reactivity of the carboxylic acid group.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c12-9(13)7-5-10-8(11-7)6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13)
InChI key:InChIKey=RMJVBXKXQDZQPP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(=NC1)C2CCCC2
Synonyms:- 1H-Imidazole-4-carboxylic acid, 2-cyclopentyl-
- 1H-Imidazole-4-carboxylicacid, 2-cyclopentyl- (9CI)
- 1H-Imidazole-5-carboxylic acid, 2-cyclopentyl-
- 2-Cyclopentyl-1H-imidazole-4-carboxylic acid
- 2-Cyclopentyl-1H-imidazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.