CAS 794501-01-2

2-[3-(trifluoromethyl)benzyl]piperidine

Description:

2-[3-(Trifluoromethyl)benzyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a benzyl group substituted at the 2-position of the piperidine, with a trifluoromethyl group attached to the benzyl moiety. This trifluoromethyl group significantly influences the compound's electronic properties, making it more lipophilic and potentially enhancing its biological activity. The presence of the trifluoromethyl group can also affect the compound's reactivity and stability. 2-[3-(Trifluoromethyl)benzyl]piperidine may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in various fields, including pharmaceuticals, where it could serve as a scaffold for the development of new therapeutic agents. As with many organic compounds, its physical properties, such as solubility, melting point, and boiling point, would depend on the specific interactions of its functional groups and overall molecular structure.

Formula: C₁₃H₁₆F₃N

InChI: InChI=1/C13H16F3N/c14-13(15,16)11-5-3-4-10(8-11)9-12-6-1-2-7-17-12/h3-5,8,12,17H,1-2,6-7,9H2

SMILES: C1CCNC(C1)Cc1cccc(c1)C(F)(F)F

Synonyms:

• Piperidine, 2-[[3-(Trifluoromethyl)Phenyl]Methyl]-
• 2-[3-(Trifluoromethyl)benzyl]piperidine

2-(3-Trifluoromethyl-Benzyl)-Piperidine

Controlled Product

CAS: 794501-01-2

Please enquire for more information about 2-(3-Trifluoromethyl-Benzyl)-Piperidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₆F₃N

Purity: Min. 95%

Molecular weight: 243.27 g/mol

Ref: 3D-FT85244