
CAS 794501-02-3
:3-(4-Piperidinylmethyl)phenol
Description:
3-(4-Piperidinylmethyl)phenol, identified by its CAS number 794501-02-3, is an organic compound characterized by the presence of a phenolic group and a piperidine moiety. This compound features a phenol ring substituted with a piperidinylmethyl group at the meta position, which contributes to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic and aliphatic components. The piperidine ring introduces basicity, allowing for potential interactions with biological targets, which may be relevant in medicinal chemistry. The compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its synthesis often involves the reaction of piperidine derivatives with phenolic compounds, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c14-12-3-1-2-11(9-12)8-10-4-6-13-7-5-10/h1-3,9-10,13-14H,4-8H2
InChI key:InChIKey=URJVOAQPKQPTIP-UHFFFAOYSA-N
SMILES:C(C1=CC(O)=CC=C1)C2CCNCC2
Synonyms:- Phenol, 3-(4-piperidinylmethyl)-
- 3-(4-Piperidinylmethyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.