CAS 794554-69-1

4-[(4-Methyl-1-piperazinyl)sulfonyl]benzoic acid hydrazide

Description:

4-[(4-Methyl-1-piperazinyl)sulfonyl]benzoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety linked to a hydrazide functional group and a piperazine ring substituted with a methyl group. This compound typically exhibits properties associated with both hydrazides and sulfonamides, such as potential biological activity and solubility in polar solvents. The presence of the piperazine ring may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The sulfonyl group enhances the compound's reactivity and can influence its interaction with biological targets. Additionally, the hydrazide functional group may participate in various chemical reactions, including condensation and hydrazone formation. Overall, this compound's characteristics suggest potential applications in drug development, particularly in the fields of anti-inflammatory or antimicrobial agents, although specific biological activities would need to be evaluated through experimental studies.

Formula: C₁₂H₁₈N₄O₃S

InChI: InChI=1S/C12H18N4O3S/c1-15-6-8-16(9-7-15)20(18,19)11-4-2-10(3-5-11)12(17)14-13/h2-5H,6-9,13H2,1H3,(H,14,17)

InChI key: InChIKey=JJDSGNGGVNMDFJ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C(NN)=O)C=C1)N2CCN(C)CC2

Synonyms:

• 4-[(4-Methyl-1-piperazinyl)sulfonyl]benzoic acid hydrazide
• Benzoic acid, 4-[(4-methyl-1-piperazinyl)sulfonyl]-, hydrazide