CAS 794554-75-9

[(4-Fluorophenyl)iminomethyl]azanyl 2-chloroacetate

Description:

[(4-Fluorophenyl)iminomethyl]azanyl 2-chloroacetate is a chemical compound characterized by its unique functional groups and structural features. It contains an imine functional group, which is formed by the condensation of an amine and a carbonyl compound, specifically linked to a 4-fluorophenyl moiety. The presence of the azanyl group indicates that it has an amine component, contributing to its basicity and potential reactivity. The 2-chloroacetate part of the molecule introduces a chloro substituent, which can influence its reactivity and solubility in various solvents. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups. Overall, the combination of these features suggests that [(4-Fluorophenyl)iminomethyl]azanyl 2-chloroacetate could be a versatile compound in synthetic chemistry and pharmacological applications.

Formula: C₉H₈ClFN₂O₂

InChI: InChI=1S/C9H8ClFN2O2/c10-5-8(14)15-13-9(12)6-1-3-7(11)4-2-6/h1-4H,5H2,(H2,12,13)

InChI key: InChIKey=OBQGNNNYOWZVNZ-UHFFFAOYSA-N

SMILES: C(NOC(CCl)=O)(=N)C1=CC=C(F)C=C1

Synonyms:

• Benzenecarboximidamide, N-[(chloroacetyl)oxy]-4-fluoro-
• Acetic acid, 2-chloro-, [(4-fluorophenyl)iminomethyl]azanyl ester
• [(4-Fluorophenyl)iminomethyl]azanyl 2-chloroacetate