CAS 794568-92-6: 1-(2-Chlorophenyl)-1,5-dihydro-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:1-(2-Chlorophenyl)-1,5-dihydro-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo[3,4-d]pyrimidine core. This compound features a chlorophenyl group and a trifluoromethyl-substituted alkyl chain, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen atoms in its ring structure. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's potential applications could include roles in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its CAS number, 794568-92-6, allows for easy identification and reference in chemical databases. As with many such compounds, understanding its reactivity, stability, and interactions with biological systems is crucial for assessing its utility in various applications.

Formula:C₁₅H₁₂ClF₃N₄O

InChI:InChI=1S/C15H12ClF3N4O/c1-8(15(17,18)19)6-12-21-13-9(14(24)22-12)7-20-23(13)11-5-3-2-4-10(11)16/h2-5,7-8H,6H2,1H3,(H,21,22,24)/t8-/m1/s1

InChI key:InChIKey=FFPXPXOAFQCNBS-MRVPVSSYSA-N

SMILES:O=C1N=C(NC2=C1C=NN2C=3C=CC=CC3Cl)CC(C)C(F)(F)F

Synonyms:
BAY 73-6691
(R)-BAY 73-6691
4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1-(2-chlorophenyl)-1,5-dihydro-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-
1-(2-Chlorophenyl)-1,5-dihydro-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one
BAY 736691

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	BAY 73-6691 REF: 3D-FB159390CAS: 794568-92-6	Min. 95%	287.00 €~794.00 €	Thu 15 May 25
	BAY 73-6691 REF: TM-T10481LCAS: 794568-92-6	- - -	63.00 €~1,415.00 €	Wed 25 Jun 25