CAS 794582-32-4

5-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid 2-(2-chloroacetyl)hydrazide

Description:

5-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid 2-(2-chloroacetyl)hydrazide, with CAS number 794582-32-4, is a chemical compound characterized by its complex structure, which includes a benzo[b]thiophene core and a hydrazide functional group. This compound features a tert-butyl group, contributing to its hydrophobic characteristics, and a chloroacetyl moiety that may enhance its reactivity and potential biological activity. The presence of the carboxylic acid group suggests that it can participate in various chemical reactions, including esterification and amidation. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can be influenced by the presence of the hydrazide and carboxylic acid functionalities. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and drug development.

Formula: C₁₅H₂₁ClN₂O₂S

InChI: InChI=1S/C15H21ClN2O2S/c1-15(2,3)10-4-5-11-9(6-10)7-12(21-11)14(20)18-17-13(19)8-16/h7,10H,4-6,8H2,1-3H3,(H,17,19)(H,18,20)

InChI key: InChIKey=JOKIKXBTFOWSCI-UHFFFAOYSA-N

SMILES: C(NNC(CCl)=O)(=O)C1=CC2=C(S1)CCC(C(C)(C)C)C2

Synonyms:

• 5-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid 2-(2-chloroacetyl)hydrazide
• Benzo[b]thiophene-2-carboxylic acid, 5-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, 2-(chloroacetyl)hydrazide
• Benzo[b]thiophene-2-carboxylic acid, 5-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, 2-(2-chloroacetyl)hydrazide

5-tert-Butyl-N'-(2-chloroacetyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide

CAS: 794582-32-4

Versatile small molecule scaffold

Formula: C₁₅H₂₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 328.9 g/mol

Ref: 3D-UGB58232