CAS 794582-37-9

N-[4-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoyl]glycine

Description:

N-[4-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoyl]glycine, with the CAS number 794582-37-9, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a glycine moiety linked to a benzoyl group, which is further substituted with a 2,5-dimethyl-1H-pyrrole ring. The presence of the pyrrole ring contributes to its unique electronic and steric properties, potentially influencing its biological activity. The compound is characterized by its ability to form hydrogen bonds due to the amine and carboxylic acid functional groups, which may enhance its solubility in polar solvents. Additionally, the dimethyl substitution on the pyrrole ring can affect its stability and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₅H₁₆N₂O₃

InChI: InChI=1S/C15H16N2O3/c1-10-3-4-11(2)17(10)13-7-5-12(6-8-13)15(20)16-9-14(18)19/h3-8H,9H2,1-2H3,(H,16,20)(H,18,19)

InChI key: InChIKey=RZJNLLRJLBSDKO-UHFFFAOYSA-N

SMILES: CC=1N(C2=CC=C(C(NCC(O)=O)=O)C=C2)C(C)=CC1

Synonyms:

• N-[4-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoyl]glycine
• Glycine, N-[4-(2,5-dimethyl-1H-pyrrol-1-yl)benzoyl]-

2-{[4-(2,5-Dimethyl-1H-pyrrol-1-yl)phenyl]formamido}acetic acid

CAS: 794582-37-9

Versatile small molecule scaffold

Formula: C₁₅H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 272.3 g/mol

Ref: 3D-UGB58237