CAS 794582-38-0

2-[(4-Nitrophenyl)thio]propanoic acid

Description:

2-[(4-Nitrophenyl)thio]propanoic acid is an organic compound characterized by the presence of a propanoic acid moiety attached to a 4-nitrophenylthio group. This compound features a sulfur atom that links the 4-nitrophenyl group to the propanoic acid, which contributes to its unique chemical properties. The nitro group (-NO2) on the phenyl ring is an electron-withdrawing group, which can influence the acidity and reactivity of the compound. As a carboxylic acid, it exhibits typical acidic behavior, capable of donating a proton in solution. The presence of the nitrophenyl group may also impart specific biological activities or interactions, making it of interest in pharmaceutical and chemical research. Additionally, the compound's structure suggests potential for various applications in organic synthesis and as a building block in the development of more complex molecules. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature.

Formula: C₉H₉NO₄S

InChI: InChI=1S/C9H9NO4S/c1-6(9(11)12)15-8-4-2-7(3-5-8)10(13)14/h2-6H,1H3,(H,11,12)

InChI key: InChIKey=ACSMBGHECSLDPA-UHFFFAOYSA-N

SMILES: S(C(C(O)=O)C)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• Propanoic acid, 2-[(4-nitrophenyl)thio]-
• 2-[(4-Nitrophenyl)thio]propanoic acid
• 2-[(4-Nitrophenyl)sulfanyl]propanoic acid

2-[(4-Nitrophenyl)sulfanyl]propanoic acid

CAS: 794582-38-0

Versatile small molecule scaffold

Formula: C₉H₉NO₄S

Purity: Min. 95%

Molecular weight: 227.24 g/mol

Ref: 3D-UGB58238