CymitQuimica logo

CAS 79461-92-0

:

2-Ethenyl-3-methylthiophene

Description:
2-Ethenyl-3-methylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a vinyl group (ethenyl) and a methyl group attached to the thiophene ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinct odor. The presence of the double bond in the ethenyl group makes it reactive, allowing it to participate in various chemical reactions, such as polymerization and electrophilic substitution. Its structure provides it with potential applications in organic synthesis and materials science, particularly in the development of conductive polymers and organic electronics. Additionally, the compound's thiophene moiety is known for its stability and ability to form π-π interactions, which can enhance its performance in electronic applications. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C7H8S
InChI:InChI=1S/C7H8S/c1-3-7-6(2)4-5-8-7/h3-5H,1H2,2H3
InChI key:InChIKey=YQNNMEFXEVCWEZ-UHFFFAOYSA-N
SMILES:C(=C)C1=C(C)C=CS1
Synonyms:
  • 2-Ethenyl-3-methylthiophene
  • Thiophene, 2-ethenyl-3-methyl-
  • 3-Methyl-2-vinylthiophene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.